C18H29NO2 — CID 101216591
(2R)-2-(phenylmethoxymethyl)decanamide (PubChem CID 101216591) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is (2R)-2-(phenylmethoxymethyl)decanamide.
| Compound Name | (2R)-2-(phenylmethoxymethyl)decanamide |
|---|---|
| PubChem CID | 101216591 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (2R)-2-(phenylmethoxymethyl)decanamide |
| SMILES | CCCCCCCC[C@H](COCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C18H29NO2/c1-2-3-4-5-6-10-13-17(18(19)20)15-21-14-16-11-8-7-9-12-16/h7-9,11-12,17H,2-6,10,13-15H2,1H3,(H2,19,20)/t17-/m1/s1 |
| InChIKey | LTOVFGGVWQMEPT-QGZVFWFLSA-N |
| XLogP | 4.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|