C29H48O3Si2 — CID 101216811
1-[(3R,3aR,9aS,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-(5-trimethylsilylfuran-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone (PubChem CID 101216811) has the molecular formula C29H48O3Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is 1-[(3R,3aR,9aS,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-(5-trimethylsilylfuran-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone.
| Compound Name | 1-[(3R,3aR,9aS,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-(5-trimethylsilylfuran-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone |
|---|---|
| PubChem CID | 101216811 |
| Molecular Formula | C29H48O3Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 1-[(3R,3aR,9aS,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-(5-trimethylsilylfuran-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone |
| SMILES | CC(=O)C1=C2CCCC[C@@H]2[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H](c3coc([Si](C)(C)C)c3)[C@@]2(C)C1 |
| InChI | InChI=1S/C29H48O3Si2/c1-20(30)23-18-28(5)24(21-17-26(31-19-21)33(6,7)8)15-16-29(28,25-14-12-11-13-22(23)25)32-34(9,10)27(2,3)4/h17,19,24-25H,11-16,18H2,1-10H3/t24-,25+,28-,29+/m1/s1 |
| InChIKey | KYSMAEQFHCJXMD-BVIJCPSYSA-N |
| XLogP | 7.95 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|