C12H13NO2 — CID 101216892
(1S,2R)-3-(pyridin-2-ylmethyl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 101216892) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (1S,2R)-3-(pyridin-2-ylmethyl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-(pyridin-2-ylmethyl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 101216892 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (1S,2R)-3-(pyridin-2-ylmethyl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | O[C@@H]1C(Cc2ccccn2)=CC=C[C@@H]1O |
| InChI | InChI=1S/C12H13NO2/c14-11-6-3-4-9(12(11)15)8-10-5-1-2-7-13-10/h1-7,11-12,14-15H,8H2/t11-,12+/m0/s1 |
| InChIKey | HESIVIOJXQHDSG-NWDGAFQWSA-N |
| XLogP | 0.84 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |