C13H18F2O5 — CID 101217216
(3aR,5S,6aR)-6-(difluoromethylidene)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxole (PubChem CID 101217216) has the molecular formula C13H18F2O5 and a molecular weight of 292.28 g/mol. Its IUPAC name is (3aR,5S,6aR)-6-(difluoromethylidene)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5S,6aR)-6-(difluoromethylidene)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 101217216 |
| Molecular Formula | C13H18F2O5 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (3aR,5S,6aR)-6-(difluoromethylidene)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)C(=C(F)F)[C@H]2O1 |
| InChI | InChI=1S/C13H18F2O5/c1-12(2)16-5-6(18-12)8-7(10(14)15)9-11(17-8)20-13(3,4)19-9/h6,8-9,11H,5H2,1-4H3/t6-,8-,9-,11-/m1/s1 |
| InChIKey | SUYWCYJECRVFIB-PNHWDRBUSA-N |
| XLogP | 2.16 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |