C42H42Si2 — CID 101217328
(17,26-ditert-butyl-8-trimethylsilyl-7-tetracyclo[22.4.0.06,9.014,19]octacosa-1,2,3,4,5,7,9,10,11,12,13,15,17,19,20,21,22,23,25,27-icosaenyl)-trimethylsilane (PubChem CID 101217328) has the molecular formula C42H42Si2 and a molecular weight of 602.97 g/mol. Its IUPAC name is (17,26-ditert-butyl-8-trimethylsilyl-7-tetracyclo[22.4.0.06,9.014,19]octacosa-1,2,3,4,5,7,9,10,11,12,13,15,17,19,20,21,22,23,25,27-icosaenyl)-trimethylsilane.
| Compound Name | (17,26-ditert-butyl-8-trimethylsilyl-7-tetracyclo[22.4.0.06,9.014,19]octacosa-1,2,3,4,5,7,9,10,11,12,13,15,17,19,20,21,22,23,25,27-icosaenyl)-trimethylsilane |
|---|---|
| PubChem CID | 101217328 |
| Molecular Formula | C42H42Si2 |
| Molecular Weight | 602.97 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | (17,26-ditert-butyl-8-trimethylsilyl-7-tetracyclo[22.4.0.06,9.014,19]octacosa-1,2,3,4,5,7,9,10,11,12,13,15,17,19,20,21,22,23,25,27-icosaenyl)-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)=C=C=C=C=c1cc(C(C)(C)C)ccc1=C=C=C=C=C1C(=C=C=C=C=2)C([Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C42H42Si2/c1-41(2,3)35-27-25-31-19-15-17-23-37-38(40(44(10,11)12)39(37)43(7,8)9)24-18-16-20-32-26-28-36(42(4,5)6)30-34(32)22-14-13-21-33(31)29-35/h25-30H,1-12H3 |
| InChIKey | COWYXJWDIYOADX-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.97 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|