C33H38N6O6 — CID 10121737
4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-[4-(2,3-dihydro-1H-indol-4-yloxy)phenyl]piperazine-1-carboxamide (PubChem CID 10121737) has the molecular formula C33H38N6O6 and a molecular weight of 614.70 g/mol. Its IUPAC name is 4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-[4-(2,3-dihydro-1H-indol-4-yloxy)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-[4-(2,3-dihydro-1H-indol-4-yloxy)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 10121737 |
| Molecular Formula | C33H38N6O6 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | 4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-[4-(2,3-dihydro-1H-indol-4-yloxy)phenyl]piperazine-1-carboxamide |
| SMILES | COCCOc1cc2ncnc(N3CCN(C(=O)Nc4ccc(Oc5cccc6c5CCN6)cc4)CC3)c2cc1OCCOC |
| InChI | InChI=1S/C33H38N6O6/c1-41-16-18-43-30-20-26-28(21-31(30)44-19-17-42-2)35-22-36-32(26)38-12-14-39(15-13-38)33(40)37-23-6-8-24(9-7-23)45-29-5-3-4-27-25(29)10-11-34-27/h3-9,20-22,34H,10-19H2,1-2H3,(H,37,40) |
| InChIKey | JEHGWHWSGLKJKF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|