C38H43F3 — CID 101217410
1-[4-(4-tert-butylphenyl)-2-fluorophenyl]-4-(4-decylphenyl)-2,3-difluorobenzene (PubChem CID 101217410) has the molecular formula C38H43F3 and a molecular weight of 556.76 g/mol. Its IUPAC name is 1-[4-(4-tert-butylphenyl)-2-fluorophenyl]-4-(4-decylphenyl)-2,3-difluorobenzene.
| Compound Name | 1-[4-(4-tert-butylphenyl)-2-fluorophenyl]-4-(4-decylphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 101217410 |
| Molecular Formula | C38H43F3 |
| Molecular Weight | 556.76 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 1-[4-(4-tert-butylphenyl)-2-fluorophenyl]-4-(4-decylphenyl)-2,3-difluorobenzene |
| SMILES | CCCCCCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(C(C)(C)C)cc4)cc3F)c(F)c2F)cc1 |
| InChI | InChI=1S/C38H43F3/c1-5-6-7-8-9-10-11-12-13-27-14-16-29(17-15-27)32-24-25-34(37(41)36(32)40)33-23-20-30(26-35(33)39)28-18-21-31(22-19-28)38(2,3)4/h14-26H,5-13H2,1-4H3 |
| InChIKey | STQHMBKINPCDEW-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.76 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|