About cinnolin-2-amine
cinnolin-2-amine (PubChem CID 101217485) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is cinnolin-2-amine.
Molecular Properties
| Compound Name | cinnolin-2-amine |
| PubChem CID | 101217485 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | cinnolin-2-amine |
| SMILES | NN1C=C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H7N3/c9-11-6-5-7-3-1-2-4-8(7)10-11/h1-4,6H,9H2 |
| InChIKey | JZITXWUDQIXVDD-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze cinnolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnolin-2-amine?
The IUPAC name of cinnolin-2-amine (CID 101217485) is cinnolin-2-amine.
What is the SMILES notation for cinnolin-2-amine?
The canonical SMILES for cinnolin-2-amine is NN1C=C=c2ccccc2=N1.
What is the InChIKey of cinnolin-2-amine?
The InChIKey is JZITXWUDQIXVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c9-11-6-5-7-3-1-2-4-8(7)10-11/h1-4,6H,9H2.
What are the key properties of cinnolin-2-amine?
cinnolin-2-amine has a molecular weight of 145.16 g/mol, XLogP of -0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnolin-2-amine is sourced from PubChem (CID 101217485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).