C24H38O8Si — CID 101217895
tetramethyl (4E,5Z)-4-ethylidene-5-(1-triethylsilylethylidene)cyclohexane-1,1,2,2-tetracarboxylate (PubChem CID 101217895) has the molecular formula C24H38O8Si and a molecular weight of 482.65 g/mol. Its IUPAC name is tetramethyl (4E,5Z)-4-ethylidene-5-(1-triethylsilylethylidene)cyclohexane-1,1,2,2-tetracarboxylate.
| Compound Name | tetramethyl (4E,5Z)-4-ethylidene-5-(1-triethylsilylethylidene)cyclohexane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 101217895 |
| Molecular Formula | C24H38O8Si |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | tetramethyl (4E,5Z)-4-ethylidene-5-(1-triethylsilylethylidene)cyclohexane-1,1,2,2-tetracarboxylate |
| SMILES | C/C=C1\CC(C(=O)OC)(C(=O)OC)C(C(=O)OC)(C(=O)OC)C\C1=C(/C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H38O8Si/c1-10-17-14-23(19(25)29-6,20(26)30-7)24(21(27)31-8,22(28)32-9)15-18(17)16(5)33(11-2,12-3)13-4/h10H,11-15H2,1-9H3/b17-10+,18-16- |
| InChIKey | WHCOQSDQEYXTCU-IUMGADTDSA-N |
| XLogP | 3.76 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|