C24H44O4Si2 — CID 101218249
6,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethyl-5,7-dihydrocyclopenta[c]pyran-3-one (PubChem CID 101218249) has the molecular formula C24H44O4Si2 and a molecular weight of 452.78 g/mol. Its IUPAC name is 6,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethyl-5,7-dihydrocyclopenta[c]pyran-3-one.
| Compound Name | 6,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethyl-5,7-dihydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 101218249 |
| Molecular Formula | C24H44O4Si2 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 6,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethyl-5,7-dihydrocyclopenta[c]pyran-3-one |
| SMILES | Cc1oc(=O)c(C)c2c1CC(CO[Si](C)(C)C(C)(C)C)(CO[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C24H44O4Si2/c1-17-19-13-24(14-20(19)18(2)28-21(17)25,15-26-29(9,10)22(3,4)5)16-27-30(11,12)23(6,7)8/h13-16H2,1-12H3 |
| InChIKey | XGDGMAXOULGGNR-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|