About (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one
(3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one (PubChem CID 101219078) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one.
Analyze (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one?
The IUPAC name of (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one (CID 101219078) is (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one.
What is the SMILES notation for (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one?
The canonical SMILES for (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one is O=C1CC[C@H]2C=CO[C@H]2C1.
What is the InChIKey of (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one?
The InChIKey is AYHFYZJLSXKHHS-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H10O2/c9-7-2-1-6-3-4-10-8(6)5-7/h3-4,6,8H,1-2,5H2/t6-,8-/m0/s1.
What are the key properties of (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one?
(3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one has a molecular weight of 138.17 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS,7aS)-4,5,7,7a-tetrahydro-3aH-1-benzofuran-6-one is sourced from PubChem (CID 101219078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).