C15H22N2O — CID 101219424
(1S,2R,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-8-one (PubChem CID 101219424) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (1S,2R,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-8-one.
| Compound Name | (1S,2R,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-8-one |
|---|---|
| PubChem CID | 101219424 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (1S,2R,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-8-one |
| SMILES | O=C1[C@@H]2C[C@@H](CN3CCCC[C@H]23)[C@H]2CCC=CN12 |
| InChI | InChI=1S/C15H22N2O/c18-15-12-9-11(13-5-2-4-8-17(13)15)10-16-7-3-1-6-14(12)16/h4,8,11-14H,1-3,5-7,9-10H2/t11-,12+,13+,14+/m0/s1 |
| InChIKey | OUUSQTVRZSKTBG-REWJHTLYSA-N |
| XLogP | 2.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |