C26H34N4 — CID 101219497
N,N'-bis(4-tert-butyl-2-isocyanophenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 101219497) has the molecular formula C26H34N4 and a molecular weight of 402.59 g/mol. Its IUPAC name is N,N'-bis(4-tert-butyl-2-isocyanophenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis(4-tert-butyl-2-isocyanophenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 101219497 |
| Molecular Formula | C26H34N4 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | N,N'-bis(4-tert-butyl-2-isocyanophenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | [C-]#[N+]c1cc(C(C)(C)C)ccc1N(C)CCN(C)c1ccc(C(C)(C)C)cc1[N+]#[C-] |
| InChI | InChI=1S/C26H34N4/c1-25(2,3)19-11-13-23(21(17-19)27-7)29(9)15-16-30(10)24-14-12-20(26(4,5)6)18-22(24)28-8/h11-14,17-18H,15-16H2,1-6,9-10H3 |
| InChIKey | DFGHOQPRHHEYGJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 15.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|