About dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate
dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate (PubChem CID 101219653) has the molecular formula C21H34O4Si
and a molecular weight of 378.59 g/mol. Its IUPAC name is dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
| PubChem CID | 101219653 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
| SMILES | CCCCCCC=C=CCC(CC#C[Si](C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H34O4Si/c1-7-8-9-10-11-12-13-14-16-21(19(22)24-2,20(23)25-3)17-15-18-26(4,5)6/h12,14H,7-11,16-17H2,1-6H3 |
| InChIKey | UNMCXRMXMOPJMH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate?
The IUPAC name of dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate (CID 101219653) is dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate.
What is the SMILES notation for dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate?
The canonical SMILES for dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate is CCCCCCC=C=CCC(CC#C[Si](C)(C)C)(C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate?
The InChIKey is UNMCXRMXMOPJMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O4Si/c1-7-8-9-10-11-12-13-14-16-21(19(22)24-2,20(23)25-3)17-15-18-26(4,5)6/h12,14H,7-11,16-17H2,1-6H3.
What are the key properties of dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate?
dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate has a molecular weight of 378.59 g/mol, XLogP of 4.66, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-deca-2,3-dienyl-2-(3-trimethylsilylprop-2-ynyl)propanedioate is sourced from PubChem (CID 101219653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).