C27H28Cl6N2O8 — CID 101220437
[(2R,3S,4R,5R,6S)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 101220437) has the molecular formula C27H28Cl6N2O8 and a molecular weight of 721.25 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101220437 |
| Molecular Formula | C27H28Cl6N2O8 |
| Molecular Weight | 721.25 g/mol |
| Exact Mass | 718.00 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H28Cl6N2O8/c1-16(36)38-14-19-21(39-12-17-8-4-2-5-9-17)22(40-13-18-10-6-3-7-11-18)20(35-25(37)41-15-26(28,29)30)23(42-19)43-24(34)27(31,32)33/h2-11,19-23,34H,12-15H2,1H3,(H,35,37)/b34-24+/t19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | VQUCCYSGYXKWBN-ZXQCKEIJSA-N |
| XLogP | 6.27 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.25 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|