C40H32N12O8P4 — CID 101220849
2,2,4,4,6,6,8,8-octapyridin-2-yloxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene (PubChem CID 101220849) has the molecular formula C40H32N12O8P4 and a molecular weight of 932.67 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octapyridin-2-yloxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene.
| Compound Name | 2,2,4,4,6,6,8,8-octapyridin-2-yloxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 101220849 |
| Molecular Formula | C40H32N12O8P4 |
| Molecular Weight | 932.67 g/mol |
| Exact Mass | 932.14 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octapyridin-2-yloxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
| SMILES | c1ccc(OP2(Oc3ccccn3)=NP(Oc3ccccn3)(Oc3ccccn3)=NP(Oc3ccccn3)(Oc3ccccn3)=NP(Oc3ccccn3)(Oc3ccccn3)=N2)nc1 |
| InChI | InChI=1S/C40H32N12O8P4/c1-9-25-41-33(17-1)53-61(54-34-18-2-10-26-42-34)49-62(55-35-19-3-11-27-43-35,56-36-20-4-12-28-44-36)51-64(59-39-23-7-15-31-47-39,60-40-24-8-16-32-48-40)52-63(50-61,57-37-21-5-13-29-45-37)58-38-22-6-14-30-46-38/h1-32H |
| InChIKey | NQLNRQHMSVFPMA-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 226.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.67 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|