C15H29NO4Si — CID 101221459
methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilylhex-4-enoate (PubChem CID 101221459) has the molecular formula C15H29NO4Si and a molecular weight of 315.49 g/mol. Its IUPAC name is methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilylhex-4-enoate.
| Compound Name | methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilylhex-4-enoate |
|---|---|
| PubChem CID | 101221459 |
| Molecular Formula | C15H29NO4Si |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilylhex-4-enoate |
| SMILES | C/C=C/[C@H]([C@@H](NC(=O)OC(C)(C)C)C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C15H29NO4Si/c1-9-10-11(21(6,7)8)12(13(17)19-5)16-14(18)20-15(2,3)4/h9-12H,1-8H3,(H,16,18)/b10-9+/t11-,12-/m1/s1 |
| InChIKey | IUAJJFLYKLQEJW-CZHKVUGUSA-N |
| XLogP | 3.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|