C15H26O2 — CID 101221526
cis-(1R,2S)-3,3-dimethyl-1-[(2S)-oxiran-2-yl]-2-[(Z)-pent-2-enyl]cyclohexan-1-ol (PubChem CID 101221526) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is cis-(1R,2S)-3,3-dimethyl-1-[(2S)-oxiran-2-yl]-2-[(Z)-pent-2-enyl]cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-3,3-dimethyl-1-[(2S)-oxiran-2-yl]-2-[(Z)-pent-2-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 101221526 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | cis-(1R,2S)-3,3-dimethyl-1-[(2S)-oxiran-2-yl]-2-[(Z)-pent-2-enyl]cyclohexan-1-ol |
| SMILES | CC/C=C\C[C@H]1C(C)(C)CCC[C@]1(O)[C@@H]1CO1 |
| InChI | InChI=1S/C15H26O2/c1-4-5-6-8-12-14(2,3)9-7-10-15(12,16)13-11-17-13/h5-6,12-13,16H,4,7-11H2,1-3H3/b6-5-/t12-,13-,15+/m0/s1 |
| InChIKey | KTZKLBOMHMXYMN-UHNNIBMRSA-N |
| XLogP | 3.30 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|