About 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate
1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate (PubChem CID 101221531) has the molecular formula C14H22N3O3-
and a molecular weight of 280.35 g/mol. Its IUPAC name is 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate |
| PubChem CID | 101221531 |
| Molecular Formula | C14H22N3O3- |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate |
| SMILES | CC1CC(c2c([O-])n(C)c(=O)n(C)c2=O)C(C(C)C)N1 |
| InChI | InChI=1S/C14H23N3O3/c1-7(2)11-9(6-8(3)15-11)10-12(18)16(4)14(20)17(5)13(10)19/h7-9,11,15,18H,6H2,1-5H3/p-1 |
| InChIKey | DZCWXHADTYTYIE-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate?
The IUPAC name of 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate (CID 101221531) is 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate.
What is the SMILES notation for 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate?
The canonical SMILES for 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate is CC1CC(c2c([O-])n(C)c(=O)n(C)c2=O)C(C(C)C)N1.
What is the InChIKey of 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate?
The InChIKey is DZCWXHADTYTYIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H23N3O3/c1-7(2)11-9(6-8(3)15-11)10-12(18)16(4)14(20)17(5)13(10)19/h7-9,11,15,18H,6H2,1-5H3/p-1.
What are the key properties of 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate?
1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate has a molecular weight of 280.35 g/mol, XLogP of -0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-(5-methyl-2-propan-2-ylpyrrolidin-3-yl)-2,6-dioxopyrimidin-4-olate is sourced from PubChem (CID 101221531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).