C10H14F9NO2S — CID 101221539
1,1,2,2,3,3,4,4,4-nonafluoro-N,N-di(propan-2-yl)butane-1-sulfonamide (PubChem CID 101221539) has the molecular formula C10H14F9NO2S and a molecular weight of 383.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-di(propan-2-yl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-di(propan-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 101221539 |
| Molecular Formula | C10H14F9NO2S |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-di(propan-2-yl)butane-1-sulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F9NO2S/c1-5(2)20(6(3)4)23(21,22)10(18,19)8(13,14)7(11,12)9(15,16)17/h5-6H,1-4H3 |
| InChIKey | DQDGTVSPDJCEBA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|