C18H14F9NO2S — CID 101221540
N,N-dibenzyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 101221540) has the molecular formula C18H14F9NO2S and a molecular weight of 479.36 g/mol. Its IUPAC name is N,N-dibenzyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N,N-dibenzyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 101221540 |
| Molecular Formula | C18H14F9NO2S |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | N,N-dibenzyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(N(Cc1ccccc1)Cc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H14F9NO2S/c19-15(20,17(23,24)25)16(21,22)18(26,27)31(29,30)28(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | ZJVKLYDKSYNABA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|