C19H16S2 — CID 101221625
(1S,4R)-2,3-bis(phenylsulfanyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 101221625) has the molecular formula C19H16S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is (1S,4R)-2,3-bis(phenylsulfanyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (1S,4R)-2,3-bis(phenylsulfanyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 101221625 |
| Molecular Formula | C19H16S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (1S,4R)-2,3-bis(phenylsulfanyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C1=C[C@H]2C[C@@H]1C(Sc1ccccc1)=C2Sc1ccccc1 |
| InChI | InChI=1S/C19H16S2/c1-3-7-16(8-4-1)20-18-14-11-12-15(13-14)19(18)21-17-9-5-2-6-10-17/h1-12,14-15H,13H2/t14-,15+ |
| InChIKey | OXKNTMCUHPEBNI-GASCZTMLSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|