C32H31F7N2O4 — CID 10122184
2-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate (PubChem CID 10122184) has the molecular formula C32H31F7N2O4 and a molecular weight of 640.60 g/mol. Its IUPAC name is 2-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate.
| Compound Name | 2-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 10122184 |
| Molecular Formula | C32H31F7N2O4 |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | 2-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(-c2ccc(C3CCC(c4c(F)cccc4F)=N3)cc2)cc1)OCCOCCOCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H31F7N2O4/c33-25-3-1-4-26(34)29(25)28-14-13-27(41-28)23-7-5-21(6-8-23)22-9-11-24(12-10-22)40-30(42)45-20-19-44-18-17-43-16-2-15-31(35,36)32(37,38)39/h1,3-12,27H,2,13-20H2,(H,40,42) |
| InChIKey | RBDPDARPOOZBRV-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|