C23H30O7S — CID 101221974
[(2R,3R)-5-(1,3-dioxolan-2-yl)-1,2-bis(phenylmethoxy)pentan-3-yl] methanesulfonate (PubChem CID 101221974) has the molecular formula C23H30O7S and a molecular weight of 450.55 g/mol. Its IUPAC name is [(2R,3R)-5-(1,3-dioxolan-2-yl)-1,2-bis(phenylmethoxy)pentan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R)-5-(1,3-dioxolan-2-yl)-1,2-bis(phenylmethoxy)pentan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 101221974 |
| Molecular Formula | C23H30O7S |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [(2R,3R)-5-(1,3-dioxolan-2-yl)-1,2-bis(phenylmethoxy)pentan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](CCC1OCCO1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H30O7S/c1-31(24,25)30-21(12-13-23-27-14-15-28-23)22(29-17-20-10-6-3-7-11-20)18-26-16-19-8-4-2-5-9-19/h2-11,21-23H,12-18H2,1H3/t21-,22-/m1/s1 |
| InChIKey | BMQWERCNDDBGHQ-FGZHOGPDSA-N |
| XLogP | 3.29 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|