About 5-phenyl-3-propan-2-yl-1,2-tellurazole
5-phenyl-3-propan-2-yl-1,2-tellurazole (PubChem CID 101221996) has the molecular formula C12H13NTe
and a molecular weight of 298.84 g/mol. Its IUPAC name is 5-phenyl-3-propan-2-yl-1,2-tellurazole.
Molecular Properties
| Compound Name | 5-phenyl-3-propan-2-yl-1,2-tellurazole |
| PubChem CID | 101221996 |
| Molecular Formula | C12H13NTe |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 5-phenyl-3-propan-2-yl-1,2-tellurazole |
| SMILES | CC(C)c1cc(-c2ccccc2)[te]n1 |
| InChI | InChI=1S/C12H13NTe/c1-9(2)11-8-12(14-13-11)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | QNVAJCAVMJLXQK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-3-propan-2-yl-1,2-tellurazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-3-propan-2-yl-1,2-tellurazole?
The IUPAC name of 5-phenyl-3-propan-2-yl-1,2-tellurazole (CID 101221996) is 5-phenyl-3-propan-2-yl-1,2-tellurazole.
What is the SMILES notation for 5-phenyl-3-propan-2-yl-1,2-tellurazole?
The canonical SMILES for 5-phenyl-3-propan-2-yl-1,2-tellurazole is CC(C)c1cc(-c2ccccc2)[te]n1.
What is the InChIKey of 5-phenyl-3-propan-2-yl-1,2-tellurazole?
The InChIKey is QNVAJCAVMJLXQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NTe/c1-9(2)11-8-12(14-13-11)10-6-4-3-5-7-10/h3-9H,1-2H3.
What are the key properties of 5-phenyl-3-propan-2-yl-1,2-tellurazole?
5-phenyl-3-propan-2-yl-1,2-tellurazole has a molecular weight of 298.84 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-3-propan-2-yl-1,2-tellurazole is sourced from PubChem (CID 101221996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).