About CID 10122258
CID 10122258 (PubChem CID 10122258) has the molecular formula C44H60N4
and a molecular weight of 644.99 g/mol.
Molecular Properties
| Compound Name | CID 10122258 |
| PubChem CID | 10122258 |
| Molecular Formula | C44H60N4 |
| Molecular Weight | 644.99 g/mol |
| Exact Mass | 644.48 |
| IUPAC Name | — |
| SMILES | c1cc2[nH]c1C1(CCCCCC1)c1ccc([nH]1)C1(CCCCCC1)c1ccc([nH]1)C1(CCCCCC1)c1ccc([nH]1)C21CCCCCC1 |
| InChI | InChI=1S/C44H60N4/c1-2-10-26-41(25-9-1)33-17-19-35(45-33)42(27-11-3-4-12-28-42)37-21-23-39(47-37)44(31-15-7-8-16-32-44)40-24-22-38(48-40)43(29-13-5-6-14-30-43)36-20-18-34(41)46-36/h17-24,45-48H,1-16,25-32H2 |
| InChIKey | RUXJOPRBZWIGLX-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.99 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 10122258 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10122258?
The IUPAC name of CID 10122258 (CID 10122258) is not available.
What is the SMILES notation for CID 10122258?
The canonical SMILES for CID 10122258 is c1cc2[nH]c1C1(CCCCCC1)c1ccc([nH]1)C1(CCCCCC1)c1ccc([nH]1)C1(CCCCCC1)c1ccc([nH]1)C21CCCCCC1.
What is the InChIKey of CID 10122258?
The InChIKey is RUXJOPRBZWIGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H60N4/c1-2-10-26-41(25-9-1)33-17-19-35(45-33)42(27-11-3-4-12-28-42)37-21-23-39(47-37)44(31-15-7-8-16-32-44)40-24-22-38(48-40)43(29-13-5-6-14-30-43)36-20-18-34(41)46-36/h17-24,45-48H,1-16,25-32H2.
What are the key properties of CID 10122258?
CID 10122258 has a molecular weight of 644.99 g/mol, XLogP of 11.87, 0 rotatable bonds, 4 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10122258 is sourced from PubChem (CID 10122258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).