C39H47N7O2 — CID 10122276
(2R)-4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)-2-N-benzyl-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)piperazine-1,2-dicarboxamide (PubChem CID 10122276) has the molecular formula C39H47N7O2 and a molecular weight of 645.85 g/mol. Its IUPAC name is (2R)-4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)-2-N-benzyl-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)piperazine-1,2-dicarboxamide.
| Compound Name | (2R)-4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)-2-N-benzyl-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)piperazine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10122276 |
| Molecular Formula | C39H47N7O2 |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.38 |
| IUPAC Name | (2R)-4-(4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)-2-N-benzyl-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)piperazine-1,2-dicarboxamide |
| SMILES | O=C([C@H]1CN(C2c3ccccc3CCc3cccnc32)CCN1C(=O)NC1CCCCC1)N(CCCn1ccnc1)Cc1ccccc1 |
| InChI | InChI=1S/C39H47N7O2/c47-38(45(27-30-11-3-1-4-12-30)23-10-22-43-24-21-40-29-43)35-28-44(25-26-46(35)39(48)42-33-15-5-2-6-16-33)37-34-17-8-7-13-31(34)18-19-32-14-9-20-41-36(32)37/h1,3-4,7-9,11-14,17,20-21,24,29,33,35,37H,2,5-6,10,15-16,18-19,22-23,25-28H2,(H,42,48)/t35-,37?/m1/s1 |
| InChIKey | OGOWVDBWUOQDSV-BNWGQQNKSA-N |
| XLogP | 5.61 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |