C26H20N2O5 — CID 101222987
5-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)oxymethylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 101222987) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 5-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)oxymethylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)oxymethylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 101222987 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 5-[(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)oxymethylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=COC2=C3OC(c4ccccc4)=CC(c4ccccc4)=C3CCC2)C(=O)N1 |
| InChI | InChI=1S/C26H20N2O5/c29-24-20(25(30)28-26(31)27-24)15-32-21-13-7-12-18-19(16-8-3-1-4-9-16)14-22(33-23(18)21)17-10-5-2-6-11-17/h1-6,8-11,14-15H,7,12-13H2,(H2,27,28,29,30,31) |
| InChIKey | ZRZKVLNQUDNPOY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|