C38H34INO4 — CID 101223070
dipropan-2-yl 10b-(4-iodophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate (PubChem CID 101223070) has the molecular formula C38H34INO4 and a molecular weight of 695.60 g/mol. Its IUPAC name is dipropan-2-yl 10b-(4-iodophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate.
| Compound Name | dipropan-2-yl 10b-(4-iodophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101223070 |
| Molecular Formula | C38H34INO4 |
| Molecular Weight | 695.60 g/mol |
| Exact Mass | 695.15 |
| IUPAC Name | dipropan-2-yl 10b-(4-iodophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
| SMILES | CC(C)OC(=O)C1=C(C(=O)OC(C)C)C2(c3ccccc3-c3ccccc32)C2(c3ccc(I)cc3)c3ccccc3CCN12 |
| InChI | InChI=1S/C38H34INO4/c1-23(2)43-35(41)33-34(36(42)44-24(3)4)40-22-21-25-11-5-8-14-30(25)38(40,26-17-19-27(39)20-18-26)37(33)31-15-9-6-12-28(31)29-13-7-10-16-32(29)37/h5-20,23-24H,21-22H2,1-4H3 |
| InChIKey | DZSXPOZTYPERJM-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|