C16H22O3 — CID 101223423
(3R,5S,11R,13R)-4,4,11,13-tetramethyl-10,14-dioxatricyclo[6.6.0.03,5]tetradeca-1(8),6-dien-9-one (PubChem CID 101223423) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3R,5S,11R,13R)-4,4,11,13-tetramethyl-10,14-dioxatricyclo[6.6.0.03,5]tetradeca-1(8),6-dien-9-one.
| Compound Name | (3R,5S,11R,13R)-4,4,11,13-tetramethyl-10,14-dioxatricyclo[6.6.0.03,5]tetradeca-1(8),6-dien-9-one |
|---|---|
| PubChem CID | 101223423 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3R,5S,11R,13R)-4,4,11,13-tetramethyl-10,14-dioxatricyclo[6.6.0.03,5]tetradeca-1(8),6-dien-9-one |
| SMILES | C[C@@H]1C[C@@H](C)OC2=C(C=C[C@H]3[C@@H](C2)C3(C)C)C(=O)O1 |
| InChI | InChI=1S/C16H22O3/c1-9-7-10(2)19-15(17)11-5-6-12-13(16(12,3)4)8-14(11)18-9/h5-6,9-10,12-13H,7-8H2,1-4H3/t9-,10-,12+,13-/m1/s1 |
| InChIKey | QDQJRYYIZJAIQE-VCDKRKBESA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |