C21H36O3Si — CID 101223966
(1S,4R,7R,8R,9R,10Z,13S)-5,5,9-trimethyl-8-triethylsilyloxy-3-oxatricyclo[5.5.1.04,13]tridec-10-en-2-one (PubChem CID 101223966) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (1S,4R,7R,8R,9R,10Z,13S)-5,5,9-trimethyl-8-triethylsilyloxy-3-oxatricyclo[5.5.1.04,13]tridec-10-en-2-one.
| Compound Name | (1S,4R,7R,8R,9R,10Z,13S)-5,5,9-trimethyl-8-triethylsilyloxy-3-oxatricyclo[5.5.1.04,13]tridec-10-en-2-one |
|---|---|
| PubChem CID | 101223966 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1S,4R,7R,8R,9R,10Z,13S)-5,5,9-trimethyl-8-triethylsilyloxy-3-oxatricyclo[5.5.1.04,13]tridec-10-en-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H]2CC(C)(C)[C@@H]3OC(=O)[C@@H](C/C=C\[C@H]1C)[C@H]23 |
| InChI | InChI=1S/C21H36O3Si/c1-7-25(8-2,9-3)24-18-14(4)11-10-12-15-17-16(18)13-21(5,6)19(17)23-20(15)22/h10-11,14-19H,7-9,12-13H2,1-6H3/b11-10-/t14-,15+,16-,17-,18-,19-/m1/s1 |
| InChIKey | AQLRBNZHNWTPKS-LHVGSSTGSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|