C24H22S — CID 101223983
(2R,4R)-2-methyl-2,4,6-triphenyl-3,4-dihydrothiopyran (PubChem CID 101223983) has the molecular formula C24H22S and a molecular weight of 342.51 g/mol. Its IUPAC name is (2R,4R)-2-methyl-2,4,6-triphenyl-3,4-dihydrothiopyran.
| Compound Name | (2R,4R)-2-methyl-2,4,6-triphenyl-3,4-dihydrothiopyran |
|---|---|
| PubChem CID | 101223983 |
| Molecular Formula | C24H22S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2R,4R)-2-methyl-2,4,6-triphenyl-3,4-dihydrothiopyran |
| SMILES | C[C@]1(c2ccccc2)C[C@@H](c2ccccc2)C=C(c2ccccc2)S1 |
| InChI | InChI=1S/C24H22S/c1-24(22-15-9-4-10-16-22)18-21(19-11-5-2-6-12-19)17-23(25-24)20-13-7-3-8-14-20/h2-17,21H,18H2,1H3/t21-,24+/m0/s1 |
| InChIKey | YTAVCVJFIRNGIA-XUZZJYLKSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |