C14H22O3 — CID 101224066
(3R,3aS,6R,7aS)-3,6-dimethyl-7-(3-oxobutyl)-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 101224066) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3R,3aS,6R,7aS)-3,6-dimethyl-7-(3-oxobutyl)-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (3R,3aS,6R,7aS)-3,6-dimethyl-7-(3-oxobutyl)-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 101224066 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3R,3aS,6R,7aS)-3,6-dimethyl-7-(3-oxobutyl)-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | CC(=O)CCC1[C@H](C)CC[C@H]2[C@@H](C)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C14H22O3/c1-8-4-6-12-10(3)14(16)17-13(12)11(8)7-5-9(2)15/h8,10-13H,4-7H2,1-3H3/t8-,10-,11?,12+,13+/m1/s1 |
| InChIKey | NJYCGXHQIJNDID-YESGXMESSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |