C22H29NO8 — CID 101224275
[(2R,3S,4R,5S,6R)-5-acetamido-3,4-diacetyloxy-6-(2-phenylethyl)oxan-2-yl]methyl acetate (PubChem CID 101224275) has the molecular formula C22H29NO8 and a molecular weight of 435.47 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-5-acetamido-3,4-diacetyloxy-6-(2-phenylethyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-5-acetamido-3,4-diacetyloxy-6-(2-phenylethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101224275 |
| Molecular Formula | C22H29NO8 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-5-acetamido-3,4-diacetyloxy-6-(2-phenylethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C22H29NO8/c1-13(24)23-20-18(11-10-17-8-6-5-7-9-17)31-19(12-28-14(2)25)21(29-15(3)26)22(20)30-16(4)27/h5-9,18-22H,10-12H2,1-4H3,(H,23,24)/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | DCONITHBCRSOAR-QMCAAQAGSA-N |
| XLogP | 1.32 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|