C19H14O — CID 101224719
(1R,2R,12R,13R)-pentacyclo[11.3.2.13,7.02,12.011,19]nonadeca-3,5,7(19),8,10,15,17-heptaen-14-one (PubChem CID 101224719) has the molecular formula C19H14O and a molecular weight of 258.32 g/mol. Its IUPAC name is (1R,2R,12R,13R)-pentacyclo[11.3.2.13,7.02,12.011,19]nonadeca-3,5,7(19),8,10,15,17-heptaen-14-one.
| Compound Name | (1R,2R,12R,13R)-pentacyclo[11.3.2.13,7.02,12.011,19]nonadeca-3,5,7(19),8,10,15,17-heptaen-14-one |
|---|---|
| PubChem CID | 101224719 |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (1R,2R,12R,13R)-pentacyclo[11.3.2.13,7.02,12.011,19]nonadeca-3,5,7(19),8,10,15,17-heptaen-14-one |
| SMILES | O=C1C=C[C@H]2C=C[C@@H]1[C@@H]1c3cccc4cccc(c34)[C@H]21 |
| InChI | InChI=1S/C19H14O/c20-16-10-8-12-7-9-13(16)19-15-6-2-4-11-3-1-5-14(17(11)15)18(12)19/h1-10,12-13,18-19H/t12-,13+,18+,19-/m1/s1 |
| InChIKey | XBZKQRCMWPNZBH-MTZMYHNQSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|