C15H19NO6 — CID 101225174
(2R,3R,4R,5S)-2-[(1-methoxyindol-3-yl)methyl]oxane-2,3,4,5-tetrol (PubChem CID 101225174) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[(1-methoxyindol-3-yl)methyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5S)-2-[(1-methoxyindol-3-yl)methyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 101225174 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2R,3R,4R,5S)-2-[(1-methoxyindol-3-yl)methyl]oxane-2,3,4,5-tetrol |
| SMILES | COn1cc(C[C@@]2(O)OC[C@H](O)[C@@H](O)[C@H]2O)c2ccccc21 |
| InChI | InChI=1S/C15H19NO6/c1-21-16-7-9(10-4-2-3-5-11(10)16)6-15(20)14(19)13(18)12(17)8-22-15/h2-5,7,12-14,17-20H,6,8H2,1H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | JKYGUSBSXUKNKE-GBJTYRQASA-N |
| XLogP | -0.96 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |