C25H17BrF7N3O4S — CID 10122521
1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethanol (PubChem CID 10122521) has the molecular formula C25H17BrF7N3O4S and a molecular weight of 668.39 g/mol. Its IUPAC name is 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 10122521 |
| Molecular Formula | C25H17BrF7N3O4S |
| Molecular Weight | 668.39 g/mol |
| Exact Mass | 667.00 |
| IUPAC Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethanol |
| SMILES | [O-][n+]1ccc(CC(c2ccc(OC(F)F)c(OC(F)F)c2)c2cnc(C(O)(c3ccc(Br)cn3)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C25H17BrF7N3O4S/c26-15-2-4-20(34-11-15)24(37,25(31,32)33)21-35-12-19(41-21)16(9-13-5-7-36(38)8-6-13)14-1-3-17(39-22(27)28)18(10-14)40-23(29)30/h1-8,10-12,16,22-23,37H,9H2 |
| InChIKey | WJYWMKPAKHUBTF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|