C39H43F3N4O3 — CID 10122579
[4-[4-[N-benzyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]methanone (PubChem CID 10122579) has the molecular formula C39H43F3N4O3 and a molecular weight of 672.79 g/mol. Its IUPAC name is [4-[4-[N-benzyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]methanone.
| Compound Name | [4-[4-[N-benzyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 10122579 |
| Molecular Formula | C39H43F3N4O3 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | [4-[4-[N-benzyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]methanone |
| SMILES | Cc1cc(-c2cc[n+]([O-])cc2)cc(C)c1C(=O)N1CCC(C)(N2CCC(N(Cc3ccccc3)c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C39H43F3N4O3/c1-28-25-32(31-13-21-45(48)22-14-31)26-29(2)36(28)37(47)43-23-17-38(3,18-24-43)44-19-15-34(16-20-44)46(27-30-7-5-4-6-8-30)33-9-11-35(12-10-33)49-39(40,41)42/h4-14,21-22,25-26,34H,15-20,23-24,27H2,1-3H3 |
| InChIKey | GHRBRNXMLRSZTO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|