C12H24O3Si — CID 101226181
tert-butyl-[[(2S,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]oxy]-dimethylsilane (PubChem CID 101226181) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is tert-butyl-[[(2S,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101226181 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | tert-butyl-[[(2S,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]oxy]-dimethylsilane |
| SMILES | CO[C@@H]1C=CC[C@H](O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C12H24O3Si/c1-12(2,3)16(5,6)15-11-9-7-8-10(13-4)14-11/h7-8,10-11H,9H2,1-6H3/t10-,11-/m0/s1 |
| InChIKey | AAKHZPFIWZRKRP-QWRGUYRKSA-N |
| XLogP | 3.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|