C17H22Si — CID 101226612
[(3E,7E)-11,11-dimethyldodeca-3,7-dien-1,5,9-triynyl]-trimethylsilane (PubChem CID 101226612) has the molecular formula C17H22Si and a molecular weight of 254.45 g/mol. Its IUPAC name is [(3E,7E)-11,11-dimethyldodeca-3,7-dien-1,5,9-triynyl]-trimethylsilane.
| Compound Name | [(3E,7E)-11,11-dimethyldodeca-3,7-dien-1,5,9-triynyl]-trimethylsilane |
|---|---|
| PubChem CID | 101226612 |
| Molecular Formula | C17H22Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [(3E,7E)-11,11-dimethyldodeca-3,7-dien-1,5,9-triynyl]-trimethylsilane |
| SMILES | CC(C)(C)C#C/C=C/C#C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H22Si/c1-17(2,3)15-13-11-9-7-8-10-12-14-16-18(4,5)6/h9-12H,1-6H3/b11-9+,12-10+ |
| InChIKey | SDVLZEZMESMHOA-WGDLNXRISA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|