C25H33N2OP — CID 101227019
[(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2-methylphenyl)phosphane (PubChem CID 101227019) has the molecular formula C25H33N2OP and a molecular weight of 408.53 g/mol. Its IUPAC name is [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2-methylphenyl)phosphane.
| Compound Name | [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 101227019 |
| Molecular Formula | C25H33N2OP |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(c1ccccc1C)N1CCC[C@H]1C1=N[C@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C25H33N2OP/c1-18-11-6-8-14-21(18)29(22-15-9-7-12-19(22)2)27-16-10-13-20(27)24-26-23(17-28-24)25(3,4)5/h6-9,11-12,14-15,20,23H,10,13,16-17H2,1-5H3/t20-,23-/m0/s1 |
| InChIKey | LKRQIKPXZNOAQC-REWPJTCUSA-N |
| XLogP | 4.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|