C36H49N9O5 — CID 10122714
(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[2-[di(propan-2-yl)amino]ethylcarbamoylamino]methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 10122714) has the molecular formula C36H49N9O5 and a molecular weight of 687.85 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[2-[di(propan-2-yl)amino]ethylcarbamoylamino]methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[2-[di(propan-2-yl)amino]ethylcarbamoylamino]methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 10122714 |
| Molecular Formula | C36H49N9O5 |
| Molecular Weight | 687.85 g/mol |
| Exact Mass | 687.39 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[2-[di(propan-2-yl)amino]ethylcarbamoylamino]methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CNC(=O)NCCN(C(C)C)C(C)C)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C36H49N9O5/c1-6-37-34(48)31-29(46)30(47)35(50-31)45-21-41-28-32(39-19-26(24-13-9-7-10-14-24)25-15-11-8-12-16-25)42-27(43-33(28)45)20-40-36(49)38-17-18-44(22(2)3)23(4)5/h7-16,21-23,26,29-31,35,46-47H,6,17-20H2,1-5H3,(H,37,48)(H2,38,40,49)(H,39,42,43)/t29-,30+,31-,35+/m0/s1 |
| InChIKey | JZTVQVQEFVILIO-XYIJYTLJSA-N |
| XLogP | 2.74 |
| TPSA | 178.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |