C34H40F5N3O5S — CID 10122806
benzyl N-[(2S)-1-[[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-1-oxo-3-(4,4,4-trifluorobutylsulfinyl)propan-2-yl]carbamate (PubChem CID 10122806) has the molecular formula C34H40F5N3O5S and a molecular weight of 697.77 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-1-oxo-3-(4,4,4-trifluorobutylsulfinyl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-1-oxo-3-(4,4,4-trifluorobutylsulfinyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 10122806 |
| Molecular Formula | C34H40F5N3O5S |
| Molecular Weight | 697.77 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-1-oxo-3-(4,4,4-trifluorobutylsulfinyl)propan-2-yl]carbamate |
| SMILES | CCc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)[C@@H](CS(=O)CCCC(F)(F)F)NC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C34H40F5N3O5S/c1-2-23-10-6-11-25(14-23)19-40-20-31(43)29(17-26-15-27(35)18-28(36)16-26)41-32(44)30(22-48(46)13-7-12-34(37,38)39)42-33(45)47-21-24-8-4-3-5-9-24/h3-6,8-11,14-16,18,29-31,40,43H,2,7,12-13,17,19-22H2,1H3,(H,41,44)(H,42,45)/t29-,30+,31+,48?/m0/s1 |
| InChIKey | XQZLWNVTNVALRL-KTDYSVQPSA-N |
| XLogP | 5.09 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |