C34H33F21O7 — CID 101228540
3-[4-[4-(2,3-dihydroxypropoxy)-2-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-henicosafluorohexadecoxy)phenyl]phenoxy]propane-1,2-diol (PubChem CID 101228540) has the molecular formula C34H33F21O7 and a molecular weight of 952.59 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dihydroxypropoxy)-2-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-henicosafluorohexadecoxy)phenyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[4-(2,3-dihydroxypropoxy)-2-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-henicosafluorohexadecoxy)phenyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 101228540 |
| Molecular Formula | C34H33F21O7 |
| Molecular Weight | 952.59 g/mol |
| Exact Mass | 952.19 |
| IUPAC Name | 3-[4-[4-(2,3-dihydroxypropoxy)-2-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-henicosafluorohexadecoxy)phenyl]phenoxy]propane-1,2-diol |
| SMILES | OCC(O)COc1ccc(-c2ccc(OCC(O)CO)cc2OCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H33F21O7/c35-25(36,26(37,38)27(39,40)28(41,42)29(43,44)30(45,46)31(47,48)32(49,50)33(51,52)34(53,54)55)11-3-1-2-4-12-60-24-13-22(62-17-20(59)15-57)9-10-23(24)18-5-7-21(8-6-18)61-16-19(58)14-56/h5-10,13,19-20,56-59H,1-4,11-12,14-17H2 |
| InChIKey | SXYAAYDXEYMCSF-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.59 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|