C13H24F3O5P — CID 101229328
(3-dipropoxyphosphoryl-1,1,1-trifluoropropan-2-yl) butanoate (PubChem CID 101229328) has the molecular formula C13H24F3O5P and a molecular weight of 348.30 g/mol. Its IUPAC name is (3-dipropoxyphosphoryl-1,1,1-trifluoropropan-2-yl) butanoate.
| Compound Name | (3-dipropoxyphosphoryl-1,1,1-trifluoropropan-2-yl) butanoate |
|---|---|
| PubChem CID | 101229328 |
| Molecular Formula | C13H24F3O5P |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (3-dipropoxyphosphoryl-1,1,1-trifluoropropan-2-yl) butanoate |
| SMILES | CCCOP(=O)(CC(OC(=O)CCC)C(F)(F)F)OCCC |
| InChI | InChI=1S/C13H24F3O5P/c1-4-7-12(17)21-11(13(14,15)16)10-22(18,19-8-5-2)20-9-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | DODJTUIDCYLTED-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|