About N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide
N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide (PubChem CID 101229344) has the molecular formula C13H12F3NO3S
and a molecular weight of 319.30 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide |
| PubChem CID | 101229344 |
| Molecular Formula | C13H12F3NO3S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide |
| SMILES | Cc1ccc(N(Cc2ccccc2)S(=O)(=O)C(F)(F)F)o1 |
| InChI | InChI=1S/C13H12F3NO3S/c1-10-7-8-12(20-10)17(21(18,19)13(14,15)16)9-11-5-3-2-4-6-11/h2-8H,9H2,1H3 |
| InChIKey | SBNLWFMDZCMQTR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide?
The IUPAC name of N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide (CID 101229344) is N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide.
What is the SMILES notation for N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide?
The canonical SMILES for N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide is Cc1ccc(N(Cc2ccccc2)S(=O)(=O)C(F)(F)F)o1.
What is the InChIKey of N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide?
The InChIKey is SBNLWFMDZCMQTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO3S/c1-10-7-8-12(20-10)17(21(18,19)13(14,15)16)9-11-5-3-2-4-6-11/h2-8H,9H2,1H3.
What are the key properties of N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide?
N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide has a molecular weight of 319.30 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide is sourced from PubChem (CID 101229344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).