C35H43F9O5 — CID 10122943
11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid (PubChem CID 10122943) has the molecular formula C35H43F9O5 and a molecular weight of 714.71 g/mol. Its IUPAC name is 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid.
| Compound Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
|---|---|
| PubChem CID | 10122943 |
| Molecular Formula | C35H43F9O5 |
| Molecular Weight | 714.71 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
| SMILES | CCCC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C35H43F9O5/c1-2-19-31(24-12-14-25(45)15-13-24)22-49-29-21-26(46)16-17-27(29)28(31)11-9-7-5-3-4-6-8-10-23(30(47)48)18-20-32(36,37)33(38,39)34(40,41)35(42,43)44/h12-17,21,23,28,45-46H,2-11,18-20,22H2,1H3,(H,47,48) |
| InChIKey | KALQZTVCVWENAW-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.71 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|