C16H29IO5 — CID 101229506
11-(iodomethyl)-11,14,14-trimethyl-7,8,12,13,17-pentaoxaspiro[5.11]heptadecane (PubChem CID 101229506) has the molecular formula C16H29IO5 and a molecular weight of 428.31 g/mol. Its IUPAC name is 11-(iodomethyl)-11,14,14-trimethyl-7,8,12,13,17-pentaoxaspiro[5.11]heptadecane.
| Compound Name | 11-(iodomethyl)-11,14,14-trimethyl-7,8,12,13,17-pentaoxaspiro[5.11]heptadecane |
|---|---|
| PubChem CID | 101229506 |
| Molecular Formula | C16H29IO5 |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 11-(iodomethyl)-11,14,14-trimethyl-7,8,12,13,17-pentaoxaspiro[5.11]heptadecane |
| SMILES | CC1(C)CCOC2(CCCCC2)OOCCC(C)(CI)OO1 |
| InChI | InChI=1S/C16H29IO5/c1-14(2)9-11-18-16(7-5-4-6-8-16)22-19-12-10-15(3,13-17)21-20-14/h4-13H2,1-3H3 |
| InChIKey | WUWMVWJWSCVZTH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|