C23H42N6 — CID 101229508
2-N,2-N-dibutyl-4-N,6-N-bis(hex-5-enyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 101229508) has the molecular formula C23H42N6 and a molecular weight of 402.63 g/mol. Its IUPAC name is 2-N,2-N-dibutyl-4-N,6-N-bis(hex-5-enyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dibutyl-4-N,6-N-bis(hex-5-enyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 101229508 |
| Molecular Formula | C23H42N6 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | 2-N,2-N-dibutyl-4-N,6-N-bis(hex-5-enyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCCCCNc1nc(NCCCCC=C)nc(N(CCCC)CCCC)n1 |
| InChI | InChI=1S/C23H42N6/c1-5-9-13-15-17-24-21-26-22(25-18-16-14-10-6-2)28-23(27-21)29(19-11-7-3)20-12-8-4/h5-6H,1-2,7-20H2,3-4H3,(H2,24,25,26,27,28) |
| InChIKey | OYSACTYIJGDVEF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|