C19H27NO8S — CID 101229929
dimethyl (2S)-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate (PubChem CID 101229929) has the molecular formula C19H27NO8S and a molecular weight of 429.49 g/mol. Its IUPAC name is dimethyl (2S)-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 101229929 |
| Molecular Formula | C19H27NO8S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | dimethyl (2S)-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO8S/c1-13-7-9-14(10-8-13)29(24,25)20(18(23)28-19(2,3)4)15(17(22)27-6)11-12-16(21)26-5/h7-10,15H,11-12H2,1-6H3/t15-/m0/s1 |
| InChIKey | FRXVGUIZSCFVBE-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|